![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. The Whisper.mp3 | 2024-02-14 15:28 | 5.0M | |
| 02. Walk In The Shadows.mp3 | 2024-02-14 15:28 | 7.7M | |
| 03. Chemical Youth (We Are Rebellion).mp3 | 2024-02-14 15:28 | 7.5M | |
| 04. No Sanctuary.mp3 | 2024-02-14 15:28 | 10M | |
| 05. I Remember Now - Anarchy-X.mp3 | 2024-02-14 15:28 | 4.0M | |
| 06. Revoluiton Calling.mp3 | 2024-02-14 15:28 | 7.4M | |
| 07. Operation- Mindcrime.mp3 | 2024-02-14 15:28 | 6.1M | |
| 08. Breaking The Silence.mp3 | 2024-02-14 15:28 | 8.0M | |
| 09. I Don't Believe In Love.mp3 | 2024-02-14 15:28 | 6.3M | |
| 10. The Lady Wore Black.mp3 | 2024-02-14 15:28 | 5.6M | |
| 11. Nightrider.mp3 | 2024-02-14 15:28 | 6.2M | |
| 12. Take Hold Of the Flame.mp3 | 2024-02-14 15:28 | 8.1M | |
| 13. Scarborough Fair.mp3 | 2024-02-14 15:28 | 4.5M | |
| 14. Raising Fear.mp3 | 2024-02-14 15:28 | 5.1M | |
| 15. Prophecy.mp3 | 2024-02-14 15:29 | 5.5M | |
| Covers/ | 2024-02-14 15:30 | - | |