![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Queen Of The Reich.mp3 | 2024-02-14 15:27 | 1.2M | |
| 02. Anarchy - X.mp3 | 2024-02-14 15:27 | 5.9M | |
| 03. Revolution Calling.mp3 | 2024-02-14 15:27 | 9.1M | |
| 04. Operation- Mindcrime.mp3 | 2024-02-14 15:27 | 7.1M | |
| 05. Speak.mp3 | 2024-02-14 15:27 | 5.3M | |
| 06. Spreading The Disease.mp3 | 2024-02-14 15:27 | 6.3M | |
| 07. Take Hold Of The Flame.mp3 | 2024-02-14 15:27 | 8.1M | |
| 09. Chemical Youth.mp3 | 2024-02-14 15:27 | 7.2M | |
| 08. The Needle Lies.mp3 | 2024-02-14 15:28 | 4.9M | |
| Back.jpg | 2024-02-14 15:28 | 480K | |
| CD.jpg | 2024-02-14 15:28 | 508K | |
| Front.jpg | 2024-02-14 15:28 | 1.1M | |
| 10. Eyes Of A Stranger.mp3 | 2024-02-14 15:28 | 11M | |