![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Covers/ | 2024-02-14 15:29 | - | |
![[IMG]](/icons/image2.gif) | queensryche-rage-for-order-1986-37438-280x280.jpg.webp | 2024-02-14 15:27 | 16K | |
![[SND]](/icons/sound2.gif) | 11 I Will Remember.mp3 | 2024-02-14 15:27 | 10M | |
| 10 Screaming In Digital.mp3 | 2024-02-14 15:27 | 8.3M | |
| 09 London.mp3 | 2024-02-14 15:27 | 12M | |
| 08 Chemical Youth (We Are Rebellion).mp3 | 2024-02-14 15:27 | 9.8M | |
| 05 The Killing Words.mp3 | 2024-02-14 15:27 | 9.0M | |
| 07 Neue Regel.mp3 | 2024-02-14 15:27 | 11M | |
| 06 Surgical Strike.mp3 | 2024-02-14 15:27 | 7.7M | |
| 04 Gonna Get Close To You.mp3 | 2024-02-14 15:26 | 11M | |
| 03 The Whisper.mp3 | 2024-02-14 15:26 | 8.3M | |
| 02 I Dream In Infra Red.mp3 | 2024-02-14 15:26 | 9.9M | |
| 01 Walk In The Shadows.mp3 | 2024-02-14 15:26 | 8.2M | |
|
|---|
