![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Ouverture.mp3 | 2024-02-14 13:44 | 1.4M | |
| 02. Never Go Back.mp3 | 2024-02-14 13:45 | 718K | |
| 03. Hi-Lo.mp3 | 2024-02-14 13:44 | 7.1M | |
| 04. My Heart Is Broken.mp3 | 2024-02-14 13:44 | 6.4M | |
| 05. Lacrymosa.mp3 | 2024-02-14 13:44 | 5.2M | |
| 06. The End Of The Dream.mp3 | 2024-02-14 13:44 | 6.8M | |
| 07. Bring Me To Life (Synthesis).mp3 | 2024-02-14 13:44 | 6.0M | |
| 08. Unraveling (Interlude).mp3 | 2024-02-14 13:44 | 2.4M | |
| 09. Imaginary.mp3 | 2024-02-14 13:44 | 5.7M | |
| 10. Secret Door.mp3 | 2024-02-14 13:44 | 5.3M | |
| 11. Lithium.mp3 | 2024-02-14 13:44 | 5.7M | |
| 12. Lost In Paradise.mp3 | 2024-02-14 13:44 | 6.6M | |
| 13. Your Star.mp3 | 2024-02-14 13:44 | 6.5M | |
| 14. My Immortal.mp3 | 2024-02-14 13:44 | 6.2M | |
| 15. The In-Between (Piano Solo).mp3 | 2024-02-14 13:44 | 3.1M | |
| 16. Imperfection (New Song).mp3 | 2024-02-14 13:44 | 6.1M | |
| Covers/ | 2024-02-14 13:45 | - | |