![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01.I Don't Believe In Love.mp3 | 2024-02-14 15:29 | 10M | |
| 02.Eyes Of A Stranger.mp3 | 2024-02-14 15:29 | 17M | |
| 03.Queen Of The Reich.mp3 | 2024-02-14 15:29 | 11M | |
| 04.The Lady Wore Black.mp3 | 2024-02-14 15:29 | 14M | |
| 05.Chemical Youth.mp3 | 2024-02-14 15:29 | 13M | |
| 06.Screaming In Digital.mp3 | 2024-02-14 15:29 | 6.4M | |
| 07.NM 156.mp3 | 2024-02-14 15:29 | 10M | |
| 08.London.mp3 | 2024-02-14 15:29 | 11M | |
| 09.The Whisper.mp3 | 2024-02-14 15:29 | 8.2M | |
| 10.Walk In The Shadows.mp3 | 2024-02-14 15:29 | 8.0M | |
| Queenryche Art.1ak.jpg | 2024-02-14 15:29 | 327K | |
