![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. X-T-C.mp3 | 2024-02-14 13:01 | 6.2M | |
| 02. Generation Clash.mp3 | 2024-02-14 13:01 | 8.9M | |
| 03. Chain Reaction.mp3 | 2024-02-14 13:01 | 6.5M | |
| 04. Love Sensation.mp3 | 2024-02-14 13:01 | 6.6M | |
| 05. Turn The Wheel.mp3 | 2024-02-14 13:01 | 6.9M | |
| 06. Hellhammer.mp3 | 2024-02-14 13:01 | 7.6M | |
| 07. Prisoner.mp3 | 2024-02-14 13:01 | 5.9M | |
| 08. I Can't Believe In You.mp3 | 2024-02-14 13:01 | 6.6M | |
| 09. Mistreated.mp3 | 2024-02-14 13:01 | 12M | |
| 10. Stand 4 What U R.mp3 | 2024-02-14 13:01 | 5.7M | |
| 11. Break The Ice.mp3 | 2024-02-14 13:01 | 5.8M | |
| 12. D-Train.mp3 | 2024-02-14 13:01 | 6.2M | |
| AlbumArtSmall.jpg | 2024-02-14 13:01 | 8.2K | |
| AlbumArt_{B5020207-474E-4720-7821-3A2ECBC79800}_Large.jpg | 2024-02-14 13:01 | 42K | |
| AlbumArt_{B5020207-474E-4720-7821-3A2ECBC79800}_Small.jpg | 2024-02-14 13:01 | 8.2K | |
| Covers/ | 2025-10-30 22:29 | - | |
| Folder.jpg | 2024-02-14 13:01 | 42K | |
